C19H24ClNO6 — CID 90807664
(2R)-2-[(4-chlorobenzoyl)amino]-5-(ethoxymethoxy)-3-(prop-2-ynoxymethyl)pentanoic acid (PubChem CID 90807664) has the molecular formula C19H24ClNO6 and a molecular weight of 397.86 g/mol. Its IUPAC name is (2R)-2-[(4-chlorobenzoyl)amino]-5-(ethoxymethoxy)-3-(prop-2-ynoxymethyl)pentanoic acid.
| Compound Name | (2R)-2-[(4-chlorobenzoyl)amino]-5-(ethoxymethoxy)-3-(prop-2-ynoxymethyl)pentanoic acid |
|---|---|
| PubChem CID | 90807664 |
| Molecular Formula | C19H24ClNO6 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2R)-2-[(4-chlorobenzoyl)amino]-5-(ethoxymethoxy)-3-(prop-2-ynoxymethyl)pentanoic acid |
| SMILES | C#CCOCC(CCOCOCC)[C@@H](NC(=O)c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C19H24ClNO6/c1-3-10-26-12-15(9-11-27-13-25-4-2)17(19(23)24)21-18(22)14-5-7-16(20)8-6-14/h1,5-8,15,17H,4,9-13H2,2H3,(H,21,22)(H,23,24)/t15?,17-/m1/s1 |
| InChIKey | FYUOSRXWJZHAIU-OMOCHNIRSA-N |
| XLogP | 2.19 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|