C31H35ClN2O5 — CID 90805942
4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-4-(hydroxycarbamoyl)-1-(methoxymethoxy)-7-phenylheptan-2-yl]benzamide (PubChem CID 90805942) has the molecular formula C31H35ClN2O5 and a molecular weight of 551.08 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-4-(hydroxycarbamoyl)-1-(methoxymethoxy)-7-phenylheptan-2-yl]benzamide.
| Compound Name | 4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-4-(hydroxycarbamoyl)-1-(methoxymethoxy)-7-phenylheptan-2-yl]benzamide |
|---|---|
| PubChem CID | 90805942 |
| Molecular Formula | C31H35ClN2O5 |
| Molecular Weight | 551.08 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethenyl]-N-[(2S,4S)-4-(hydroxycarbamoyl)-1-(methoxymethoxy)-7-phenylheptan-2-yl]benzamide |
| SMILES | COCOC[C@H](C[C@H](CCCc1ccccc1)C(=O)NO)NC(=O)c1ccc(C=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H35ClN2O5/c1-38-22-39-21-29(20-27(31(36)34-37)9-5-8-23-6-3-2-4-7-23)33-30(35)26-16-12-24(13-17-26)10-11-25-14-18-28(32)19-15-25/h2-4,6-7,10-19,27,29,37H,5,8-9,20-22H2,1H3,(H,33,35)(H,34,36)/t27-,29-/m0/s1 |
| InChIKey | GWAAOOPZZPHTID-YTMVLYRLSA-N |
| XLogP | 5.76 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.08 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|