C21H31N3O8 — CID 22093924
4-cyano-N-[5-(hydroxyamino)-1-(2-methoxyethoxymethoxy)-4-(2-methoxyethoxymethyl)-5-oxopentan-2-yl]benzamide (PubChem CID 22093924) has the molecular formula C21H31N3O8 and a molecular weight of 453.49 g/mol. Its IUPAC name is 4-cyano-N-[5-(hydroxyamino)-1-(2-methoxyethoxymethoxy)-4-(2-methoxyethoxymethyl)-5-oxopentan-2-yl]benzamide.
| Compound Name | 4-cyano-N-[5-(hydroxyamino)-1-(2-methoxyethoxymethoxy)-4-(2-methoxyethoxymethyl)-5-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 22093924 |
| Molecular Formula | C21H31N3O8 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-cyano-N-[5-(hydroxyamino)-1-(2-methoxyethoxymethoxy)-4-(2-methoxyethoxymethyl)-5-oxopentan-2-yl]benzamide |
| SMILES | COCCOCOCC(CC(COCCOC)C(=O)NO)NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H31N3O8/c1-28-7-9-30-13-18(21(26)24-27)11-19(14-32-15-31-10-8-29-2)23-20(25)17-5-3-16(12-22)4-6-17/h3-6,18-19,27H,7-11,13-15H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | DZJRZOHUCUDJKY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|