C21H28N2O6 — CID 12074072
prop-2-enyl (2R,4S)-4-[(4-cyanobenzoyl)amino]-5-(ethoxymethoxy)-2-(methoxymethyl)pentanoate (PubChem CID 12074072) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-4-[(4-cyanobenzoyl)amino]-5-(ethoxymethoxy)-2-(methoxymethyl)pentanoate.
| Compound Name | prop-2-enyl (2R,4S)-4-[(4-cyanobenzoyl)amino]-5-(ethoxymethoxy)-2-(methoxymethyl)pentanoate |
|---|---|
| PubChem CID | 12074072 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | prop-2-enyl (2R,4S)-4-[(4-cyanobenzoyl)amino]-5-(ethoxymethoxy)-2-(methoxymethyl)pentanoate |
| SMILES | C=CCOC(=O)[C@@H](COC)C[C@@H](COCOCC)NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H28N2O6/c1-4-10-29-21(25)18(13-26-3)11-19(14-28-15-27-5-2)23-20(24)17-8-6-16(12-22)7-9-17/h4,6-9,18-19H,1,5,10-11,13-15H2,2-3H3,(H,23,24)/t18-,19+/m1/s1 |
| InChIKey | NTNPSHRRYPPSGV-MOPGFXCFSA-N |
| XLogP | 2.05 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|