C23H36N2O7Si — CID 59064560
prop-2-enyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethyl)-4-[(4-nitrobenzoyl)amino]pentanoate (PubChem CID 59064560) has the molecular formula C23H36N2O7Si and a molecular weight of 480.63 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethyl)-4-[(4-nitrobenzoyl)amino]pentanoate.
| Compound Name | prop-2-enyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethyl)-4-[(4-nitrobenzoyl)amino]pentanoate |
|---|---|
| PubChem CID | 59064560 |
| Molecular Formula | C23H36N2O7Si |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | prop-2-enyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethyl)-4-[(4-nitrobenzoyl)amino]pentanoate |
| SMILES | C=CCOC(=O)[C@@H](COC)C[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H36N2O7Si/c1-8-13-31-22(27)18(15-30-5)14-19(16-32-33(6,7)23(2,3)4)24-21(26)17-9-11-20(12-10-17)25(28)29/h8-12,18-19H,1,13-16H2,2-7H3,(H,24,26)/t18-,19+/m1/s1 |
| InChIKey | XTAAJISFEFGRRG-MOPGFXCFSA-N |
| XLogP | 4.10 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|