C21H23N3O7 — CID 20590829
[(2S,4S)-4-benzyl-5-(hydroxyamino)-2-[(4-nitrobenzoyl)amino]-5-oxopentyl] acetate (PubChem CID 20590829) has the molecular formula C21H23N3O7 and a molecular weight of 429.43 g/mol. Its IUPAC name is [(2S,4S)-4-benzyl-5-(hydroxyamino)-2-[(4-nitrobenzoyl)amino]-5-oxopentyl] acetate.
| Compound Name | [(2S,4S)-4-benzyl-5-(hydroxyamino)-2-[(4-nitrobenzoyl)amino]-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 20590829 |
| Molecular Formula | C21H23N3O7 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [(2S,4S)-4-benzyl-5-(hydroxyamino)-2-[(4-nitrobenzoyl)amino]-5-oxopentyl] acetate |
| SMILES | CC(=O)OC[C@H](C[C@H](Cc1ccccc1)C(=O)NO)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23N3O7/c1-14(25)31-13-18(22-20(26)16-7-9-19(10-8-16)24(29)30)12-17(21(27)23-28)11-15-5-3-2-4-6-15/h2-10,17-18,28H,11-13H2,1H3,(H,22,26)(H,23,27)/t17-,18-/m0/s1 |
| InChIKey | OCRCKCAAQZNJBJ-ROUUACIJSA-N |
| XLogP | 2.01 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|