C24H27IN2O5 — CID 22093679
N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-(2-iodoethynyl)benzamide (PubChem CID 22093679) has the molecular formula C24H27IN2O5 and a molecular weight of 550.39 g/mol. Its IUPAC name is N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-(2-iodoethynyl)benzamide.
| Compound Name | N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-(2-iodoethynyl)benzamide |
|---|---|
| PubChem CID | 22093679 |
| Molecular Formula | C24H27IN2O5 |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-(2-iodoethynyl)benzamide |
| SMILES | CCOCOC[C@H](C[C@H](Cc1ccccc1)C(=O)NO)NC(=O)c1ccc(C#CI)cc1 |
| InChI | InChI=1S/C24H27IN2O5/c1-2-31-17-32-16-22(26-23(28)20-10-8-18(9-11-20)12-13-25)15-21(24(29)27-30)14-19-6-4-3-5-7-19/h3-11,21-22,30H,2,14-17H2,1H3,(H,26,28)(H,27,29)/t21-,22-/m0/s1 |
| InChIKey | BKMFOTIWDFJZIC-VXKWHMMOSA-N |
| XLogP | 3.29 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|