C22H33N3O6 — CID 22093669
N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-1-formylpiperidine-4-carboxamide (PubChem CID 22093669) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-1-formylpiperidine-4-carboxamide.
| Compound Name | N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-1-formylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22093669 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[(2S,4S)-4-benzyl-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-1-formylpiperidine-4-carboxamide |
| SMILES | CCOCOC[C@H](C[C@H](Cc1ccccc1)C(=O)NO)NC(=O)C1CCN(C=O)CC1 |
| InChI | InChI=1S/C22H33N3O6/c1-2-30-16-31-14-20(23-21(27)18-8-10-25(15-26)11-9-18)13-19(22(28)24-29)12-17-6-4-3-5-7-17/h3-7,15,18-20,29H,2,8-14,16H2,1H3,(H,23,27)(H,24,28)/t19-,20-/m0/s1 |
| InChIKey | AAJOLZHIPZPVJF-PMACEKPBSA-N |
| XLogP | 1.10 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|