C23H37N3O5 — CID 59901683
N-[(2S,4S)-4-[(3-aminophenyl)methyl]-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-methylcyclohexane-1-carboxamide (PubChem CID 59901683) has the molecular formula C23H37N3O5 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[(2S,4S)-4-[(3-aminophenyl)methyl]-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-[(2S,4S)-4-[(3-aminophenyl)methyl]-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59901683 |
| Molecular Formula | C23H37N3O5 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | N-[(2S,4S)-4-[(3-aminophenyl)methyl]-1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-methylcyclohexane-1-carboxamide |
| SMILES | CCOCOC[C@H](C[C@H](Cc1cccc(N)c1)C(=O)NO)NC(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C23H37N3O5/c1-3-30-15-31-14-21(25-22(27)18-9-7-16(2)8-10-18)13-19(23(28)26-29)11-17-5-4-6-20(24)12-17/h4-6,12,16,18-19,21,29H,3,7-11,13-15,24H2,1-2H3,(H,25,27)(H,26,28)/t16?,18?,19-,21-/m0/s1 |
| InChIKey | JSSAICTYKCGWIG-JBZVSFTFSA-N |
| XLogP | 2.64 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|