C18H25BrN2O5 — CID 22093902
4-bromo-N-[1-(ethoxymethoxy)-4-(hydroxycarbamoyl)hept-6-en-2-yl]benzamide (PubChem CID 22093902) has the molecular formula C18H25BrN2O5 and a molecular weight of 429.31 g/mol. Its IUPAC name is 4-bromo-N-[1-(ethoxymethoxy)-4-(hydroxycarbamoyl)hept-6-en-2-yl]benzamide.
| Compound Name | 4-bromo-N-[1-(ethoxymethoxy)-4-(hydroxycarbamoyl)hept-6-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22093902 |
| Molecular Formula | C18H25BrN2O5 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-bromo-N-[1-(ethoxymethoxy)-4-(hydroxycarbamoyl)hept-6-en-2-yl]benzamide |
| SMILES | C=CCC(CC(COCOCC)NC(=O)c1ccc(Br)cc1)C(=O)NO |
| InChI | InChI=1S/C18H25BrN2O5/c1-3-5-14(18(23)21-24)10-16(11-26-12-25-4-2)20-17(22)13-6-8-15(19)9-7-13/h3,6-9,14,16,24H,1,4-5,10-12H2,2H3,(H,20,22)(H,21,23) |
| InChIKey | KTYLTVQRGMGSHJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|