C16H23N3O7 — CID 22093743
N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-4-nitrobenzamide (PubChem CID 22093743) has the molecular formula C16H23N3O7 and a molecular weight of 369.37 g/mol. Its IUPAC name is N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 22093743 |
| Molecular Formula | C16H23N3O7 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-4-nitrobenzamide |
| SMILES | CCOCOC[C@H](C[C@H](C)C(=O)NO)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H23N3O7/c1-3-25-10-26-9-13(8-11(2)15(20)18-22)17-16(21)12-4-6-14(7-5-12)19(23)24/h4-7,11,13,22H,3,8-10H2,1-2H3,(H,17,21)(H,18,20)/t11-,13-/m0/s1 |
| InChIKey | NBOPLHGBSHBJPQ-AAEUAGOBSA-N |
| XLogP | 1.24 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|