C15H21N3O7 — CID 22344777
N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide (PubChem CID 22344777) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 22344777 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[1-(ethoxymethoxy)-5-(hydroxyamino)-5-oxopentan-2-yl]-4-nitrobenzamide |
| SMILES | CCOCOCC(CCC(=O)NO)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H21N3O7/c1-2-24-10-25-9-12(5-8-14(19)17-21)16-15(20)11-3-6-13(7-4-11)18(22)23/h3-4,6-7,12,21H,2,5,8-10H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | COMPEQNWYZIHTD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|