C17H25N3O7 — CID 59901549
N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-N-methyl-4-nitrobenzamide (PubChem CID 59901549) has the molecular formula C17H25N3O7 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-N-methyl-4-nitrobenzamide.
| Compound Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-N-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 59901549 |
| Molecular Formula | C17H25N3O7 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-N-methyl-4-nitrobenzamide |
| SMILES | CCOCOC[C@H](C[C@H](C)C(=O)NO)N(C)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H25N3O7/c1-4-26-11-27-10-15(9-12(2)16(21)18-23)19(3)17(22)13-5-7-14(8-6-13)20(24)25/h5-8,12,15,23H,4,9-11H2,1-3H3,(H,18,21)/t12-,15-/m0/s1 |
| InChIKey | WNDOEKRGTKWWEX-WFASDCNBSA-N |
| XLogP | 1.58 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|