C23H32N4O9 — CID 59901604
(2R,4R)-4-(ethoxymethoxymethyl)-N-hydroxy-6-(4-nitrophenyl)-6-oxo-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]hexanamide (PubChem CID 59901604) has the molecular formula C23H32N4O9 and a molecular weight of 508.53 g/mol. Its IUPAC name is (2R,4R)-4-(ethoxymethoxymethyl)-N-hydroxy-6-(4-nitrophenyl)-6-oxo-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]hexanamide.
| Compound Name | (2R,4R)-4-(ethoxymethoxymethyl)-N-hydroxy-6-(4-nitrophenyl)-6-oxo-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]hexanamide |
|---|---|
| PubChem CID | 59901604 |
| Molecular Formula | C23H32N4O9 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | (2R,4R)-4-(ethoxymethoxymethyl)-N-hydroxy-6-(4-nitrophenyl)-6-oxo-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]hexanamide |
| SMILES | CCOCOC[C@@H](CC(=O)c1ccc([N+](=O)[O-])cc1)C[C@H](CN1C(=O)N(C)C(C)(C)C1=O)C(=O)NO |
| InChI | InChI=1S/C23H32N4O9/c1-5-35-14-36-13-15(11-19(28)16-6-8-18(9-7-16)27(33)34)10-17(20(29)24-32)12-26-21(30)23(2,3)25(4)22(26)31/h6-9,15,17,32H,5,10-14H2,1-4H3,(H,24,29)/t15-,17-/m1/s1 |
| InChIKey | JVOYOXVPWKKFJN-NVXWUHKLSA-N |
| XLogP | 1.98 |
| TPSA | 168.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|