C21H25ClN2O5 — CID 22093883
4-(4-chlorophenyl)-N-[5-(hydroxyamino)-1-(methoxymethoxy)-5-oxopentan-2-yl]-N-methylbenzamide (PubChem CID 22093883) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[5-(hydroxyamino)-1-(methoxymethoxy)-5-oxopentan-2-yl]-N-methylbenzamide.
| Compound Name | 4-(4-chlorophenyl)-N-[5-(hydroxyamino)-1-(methoxymethoxy)-5-oxopentan-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 22093883 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[5-(hydroxyamino)-1-(methoxymethoxy)-5-oxopentan-2-yl]-N-methylbenzamide |
| SMILES | COCOCC(CCC(=O)NO)N(C)C(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25ClN2O5/c1-24(19(13-29-14-28-2)11-12-20(25)23-27)21(26)17-5-3-15(4-6-17)16-7-9-18(22)10-8-16/h3-10,19,27H,11-14H2,1-2H3,(H,23,25) |
| InChIKey | CEZHOXTWASPKCO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|