C22H20ClNO3 — CID 89311751
4-[2-[4-(4-chlorophenyl)phenyl]propoxy]-N-hydroxybenzamide (PubChem CID 89311751) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is 4-[2-[4-(4-chlorophenyl)phenyl]propoxy]-N-hydroxybenzamide.
| Compound Name | 4-[2-[4-(4-chlorophenyl)phenyl]propoxy]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 89311751 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-[2-[4-(4-chlorophenyl)phenyl]propoxy]-N-hydroxybenzamide |
| SMILES | CC(COc1ccc(C(=O)NO)cc1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClNO3/c1-15(14-27-21-12-8-19(9-13-21)22(25)24-26)16-2-4-17(5-3-16)18-6-10-20(23)11-7-18/h2-13,15,26H,14H2,1H3,(H,24,25) |
| InChIKey | DWJRFOGLEGEWAK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|