C27H34F3N5O3 — CID 163985652
N-[2-[(2S,4S)-4-[(4-hydroxy-4-pyridin-2-ylcyclohexyl)amino]-2-(methoxymethyl)pyrrolidin-1-yl]-2-iminoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 163985652) has the molecular formula C27H34F3N5O3 and a molecular weight of 533.60 g/mol. Its IUPAC name is N-[2-[(2S,4S)-4-[(4-hydroxy-4-pyridin-2-ylcyclohexyl)amino]-2-(methoxymethyl)pyrrolidin-1-yl]-2-iminoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(2S,4S)-4-[(4-hydroxy-4-pyridin-2-ylcyclohexyl)amino]-2-(methoxymethyl)pyrrolidin-1-yl]-2-iminoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163985652 |
| Molecular Formula | C27H34F3N5O3 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-[2-[(2S,4S)-4-[(4-hydroxy-4-pyridin-2-ylcyclohexyl)amino]-2-(methoxymethyl)pyrrolidin-1-yl]-2-iminoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\CNC(=O)c1cccc(C(F)(F)F)c1)N1C[C@@H](NC2CCC(O)(c3ccccn3)CC2)C[C@H]1COC |
| InChI | InChI=1S/C27H34F3N5O3/c1-38-17-22-14-21(34-20-8-10-26(37,11-9-20)23-7-2-3-12-32-23)16-35(22)24(31)15-33-25(36)18-5-4-6-19(13-18)27(28,29)30/h2-7,12-13,20-22,31,34,37H,8-11,14-17H2,1H3,(H,33,36)/b31-24+/t20?,21-,22-,26?/m0/s1 |
| InChIKey | IASMCIOEFWHXSX-JYQHVNDASA-N |
| XLogP | 3.32 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|