C29H37F3N4O3 — CID 174643282
N-[2-[(3S)-3-[[4-hydroxy-4-(4-pyridin-2-ylbutyl)cyclohexyl]amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 174643282) has the molecular formula C29H37F3N4O3 and a molecular weight of 546.63 g/mol. Its IUPAC name is N-[2-[(3S)-3-[[4-hydroxy-4-(4-pyridin-2-ylbutyl)cyclohexyl]amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(3S)-3-[[4-hydroxy-4-(4-pyridin-2-ylbutyl)cyclohexyl]amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174643282 |
| Molecular Formula | C29H37F3N4O3 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | N-[2-[(3S)-3-[[4-hydroxy-4-(4-pyridin-2-ylbutyl)cyclohexyl]amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CC[C@H](NC2CCC(O)(CCCCc3ccccn3)CC2)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H37F3N4O3/c30-29(31,32)22-7-5-6-21(18-22)27(38)34-19-26(37)36-17-12-25(20-36)35-24-10-14-28(39,15-11-24)13-3-1-8-23-9-2-4-16-33-23/h2,4-7,9,16,18,24-25,35,39H,1,3,8,10-15,17,19-20H2,(H,34,38)/t24?,25-,28?/m0/s1 |
| InChIKey | YFSAYKPFIMVSIG-WRDKWTGGSA-N |
| XLogP | 4.11 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|