C28H36F3N5O3 — CID 174630443
N-[2-[(3S)-3-[(2-butyl-4-hydroxy-4-pyrazin-2-ylcyclohexyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 174630443) has the molecular formula C28H36F3N5O3 and a molecular weight of 547.62 g/mol. Its IUPAC name is N-[2-[(3S)-3-[(2-butyl-4-hydroxy-4-pyrazin-2-ylcyclohexyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(3S)-3-[(2-butyl-4-hydroxy-4-pyrazin-2-ylcyclohexyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174630443 |
| Molecular Formula | C28H36F3N5O3 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | N-[2-[(3S)-3-[(2-butyl-4-hydroxy-4-pyrazin-2-ylcyclohexyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCCCC1CC(O)(c2cnccn2)CCC1N[C@H]1CCN(C(=O)CNC(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C28H36F3N5O3/c1-2-3-5-20-15-27(39,24-16-32-11-12-33-24)10-8-23(20)35-22-9-13-36(18-22)25(37)17-34-26(38)19-6-4-7-21(14-19)28(29,30)31/h4,6-7,11-12,14,16,20,22-23,35,39H,2-3,5,8-10,13,15,17-18H2,1H3,(H,34,38)/t20?,22-,23?,27?/m0/s1 |
| InChIKey | ZENIAKWHPIMQJD-OJPCTCODSA-N |
| XLogP | 3.66 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |