C11H21N3OS2 — CID 163986244
N',N'-diethyl-2-morpholin-4-ylpropanedithioamide (PubChem CID 163986244) has the molecular formula C11H21N3OS2 and a molecular weight of 275.44 g/mol. Its IUPAC name is N',N'-diethyl-2-morpholin-4-ylpropanedithioamide.
| Compound Name | N',N'-diethyl-2-morpholin-4-ylpropanedithioamide |
|---|---|
| PubChem CID | 163986244 |
| Molecular Formula | C11H21N3OS2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N',N'-diethyl-2-morpholin-4-ylpropanedithioamide |
| SMILES | CCN(CC)C(=S)C(C(N)=S)N1CCOCC1 |
| InChI | InChI=1S/C11H21N3OS2/c1-3-13(4-2)11(17)9(10(12)16)14-5-7-15-8-6-14/h9H,3-8H2,1-2H3,(H2,12,16) |
| InChIKey | TWPOFDSUBPMIGF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|