About [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide
[(N'-butylcarbamimidoyl)-methylazaniumyl]azanide (PubChem CID 163987125) has the molecular formula C6H16N4
and a molecular weight of 144.22 g/mol. Its IUPAC name is [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide.
Molecular Properties
| Compound Name | [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide |
| PubChem CID | 163987125 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide |
| SMILES | CCCC/N=C(\N)[NH+](C)[NH-] |
| InChI | InChI=1S/C6H16N4/c1-3-4-5-9-6(7)10(2)8/h8,10H,3-5H2,1-2H3,(H2,7,9) |
| InChIKey | TXIHBQXVIAFIBI-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide?
The IUPAC name of [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide (CID 163987125) is [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide.
What is the SMILES notation for [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide?
The canonical SMILES for [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide is CCCC/N=C(\N)[NH+](C)[NH-].
What is the InChIKey of [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide?
The InChIKey is TXIHBQXVIAFIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N4/c1-3-4-5-9-6(7)10(2)8/h8,10H,3-5H2,1-2H3,(H2,7,9).
What are the key properties of [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide?
[(N'-butylcarbamimidoyl)-methylazaniumyl]azanide has a molecular weight of 144.22 g/mol, XLogP of -0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(N'-butylcarbamimidoyl)-methylazaniumyl]azanide is sourced from PubChem (CID 163987125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).