About 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea
3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea (PubChem CID 163987191) has the molecular formula C14H33N5S
and a molecular weight of 303.52 g/mol. Its IUPAC name is 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea.
Molecular Properties
| Compound Name | 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea |
| PubChem CID | 163987191 |
| Molecular Formula | C14H33N5S |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea |
| SMILES | CCCCCN(C)C(=S)NC(CNC)(CNC)CNC |
| InChI | InChI=1S/C14H33N5S/c1-6-7-8-9-19(5)13(20)18-14(10-15-2,11-16-3)12-17-4/h15-17H,6-12H2,1-5H3,(H,18,20) |
| InChIKey | TXJLWIRLLKATJO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea?
The IUPAC name of 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea (CID 163987191) is 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea.
What is the SMILES notation for 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea?
The canonical SMILES for 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea is CCCCCN(C)C(=S)NC(CNC)(CNC)CNC.
What is the InChIKey of 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea?
The InChIKey is TXJLWIRLLKATJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H33N5S/c1-6-7-8-9-19(5)13(20)18-14(10-15-2,11-16-3)12-17-4/h15-17H,6-12H2,1-5H3,(H,18,20).
What are the key properties of 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea?
3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea has a molecular weight of 303.52 g/mol, XLogP of 0.38, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea is sourced from PubChem (CID 163987191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).