C14H33N5S — CID 163987191
3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea (PubChem CID 163987191) has the molecular formula C14H33N5S and a molecular weight of 303.52 g/mol. Its IUPAC name is 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea.
| Compound Name | 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea |
|---|---|
| PubChem CID | 163987191 |
| Molecular Formula | C14H33N5S |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | 3-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-1-methyl-1-pentylthiourea |
| SMILES | CCCCCN(C)C(=S)NC(CNC)(CNC)CNC |
| InChI | InChI=1S/C14H33N5S/c1-6-7-8-9-19(5)13(20)18-14(10-15-2,11-16-3)12-17-4/h15-17H,6-12H2,1-5H3,(H,18,20) |
| InChIKey | TXJLWIRLLKATJO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|