C9H11F2N3 — CID 163989332
2-(2,2-difluoroethyl)-1,7a-dihydroindazol-5-amine (PubChem CID 163989332) has the molecular formula C9H11F2N3 and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1,7a-dihydroindazol-5-amine.
| Compound Name | 2-(2,2-difluoroethyl)-1,7a-dihydroindazol-5-amine |
|---|---|
| PubChem CID | 163989332 |
| Molecular Formula | C9H11F2N3 |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1,7a-dihydroindazol-5-amine |
| SMILES | NC1=CC2=CN(CC(F)F)NC2C=C1 |
| InChI | InChI=1S/C9H11F2N3/c10-9(11)5-14-4-6-3-7(12)1-2-8(6)13-14/h1-4,8-9,13H,5,12H2 |
| InChIKey | TZFBUHOAMGGIGW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |