About 2-(trifluoromethyl)-2H-pyridine-1,4-diamine
2-(trifluoromethyl)-2H-pyridine-1,4-diamine (PubChem CID 141002270) has the molecular formula C6H8F3N3
and a molecular weight of 179.15 g/mol. Its IUPAC name is 2-(trifluoromethyl)-2H-pyridine-1,4-diamine.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-2H-pyridine-1,4-diamine |
| PubChem CID | 141002270 |
| Molecular Formula | C6H8F3N3 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-(trifluoromethyl)-2H-pyridine-1,4-diamine |
| SMILES | NC1=CC(C(F)(F)F)N(N)C=C1 |
| InChI | InChI=1S/C6H8F3N3/c7-6(8,9)5-3-4(10)1-2-12(5)11/h1-3,5H,10-11H2 |
| InChIKey | SJXXEJPHXWTCTE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)-2H-pyridine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-2H-pyridine-1,4-diamine?
The IUPAC name of 2-(trifluoromethyl)-2H-pyridine-1,4-diamine (CID 141002270) is 2-(trifluoromethyl)-2H-pyridine-1,4-diamine.
What is the SMILES notation for 2-(trifluoromethyl)-2H-pyridine-1,4-diamine?
The canonical SMILES for 2-(trifluoromethyl)-2H-pyridine-1,4-diamine is NC1=CC(C(F)(F)F)N(N)C=C1.
What is the InChIKey of 2-(trifluoromethyl)-2H-pyridine-1,4-diamine?
The InChIKey is SJXXEJPHXWTCTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3N3/c7-6(8,9)5-3-4(10)1-2-12(5)11/h1-3,5H,10-11H2.
What are the key properties of 2-(trifluoromethyl)-2H-pyridine-1,4-diamine?
2-(trifluoromethyl)-2H-pyridine-1,4-diamine has a molecular weight of 179.15 g/mol, XLogP of 0.46, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-2H-pyridine-1,4-diamine is sourced from PubChem (CID 141002270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).