C12H23F2N3 — CID 143410206
(Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine;ethane (PubChem CID 143410206) has the molecular formula C12H23F2N3 and a molecular weight of 247.33 g/mol. Its IUPAC name is (Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine;ethane.
| Compound Name | (Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 143410206 |
| Molecular Formula | C12H23F2N3 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine;ethane |
| SMILES | C/C=C(\C=C/CC)N(N)/C=C(\N)C(F)F.CC |
| InChI | InChI=1S/C10H17F2N3.C2H6/c1-3-5-6-8(4-2)15(14)7-9(13)10(11)12;1-2/h4-7,10H,3,13-14H2,1-2H3;1-2H3/b6-5-,8-4+,9-7-; |
| InChIKey | CRJHEQXXYXSBHB-KLVSSZNKSA-N |
| XLogP | 3.12 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|