C13H28N2 — CID 145001559
ethane;1-ethenyl-1-[(3Z)-hexa-1,3-dien-3-yl]-2-methylhydrazine (PubChem CID 145001559) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;1-ethenyl-1-[(3Z)-hexa-1,3-dien-3-yl]-2-methylhydrazine.
| Compound Name | ethane;1-ethenyl-1-[(3Z)-hexa-1,3-dien-3-yl]-2-methylhydrazine |
|---|---|
| PubChem CID | 145001559 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | ethane;1-ethenyl-1-[(3Z)-hexa-1,3-dien-3-yl]-2-methylhydrazine |
| SMILES | C=C/C(=C/CC)N(C=C)NC.CC.CC |
| InChI | InChI=1S/C9H16N2.2C2H6/c1-5-8-9(6-2)11(7-3)10-4;2*1-2/h6-8,10H,2-3,5H2,1,4H3;2*1-2H3/b9-8-;; |
| InChIKey | TYIURPHMIGGFHY-ULDSSAIZSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|