C10H17F2N3 — CID 143410207
(Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine (PubChem CID 143410207) has the molecular formula C10H17F2N3 and a molecular weight of 217.26 g/mol. Its IUPAC name is (Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine.
| Compound Name | (Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine |
|---|---|
| PubChem CID | 143410207 |
| Molecular Formula | C10H17F2N3 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | (Z)-1-[amino-[(2E,4Z)-hepta-2,4-dien-3-yl]amino]-3,3-difluoroprop-1-en-2-amine |
| SMILES | C/C=C(\C=C/CC)N(N)/C=C(\N)C(F)F |
| InChI | InChI=1S/C10H17F2N3/c1-3-5-6-8(4-2)15(14)7-9(13)10(11)12/h4-7,10H,3,13-14H2,1-2H3/b6-5-,8-4+,9-7- |
| InChIKey | OIPZJNKNEWWIID-IRDJHOSWSA-N |
| XLogP | 2.10 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|