C14H30N2 — CID 145001618
ethane;1-[(3Z)-hexa-1,3-dien-3-yl]-2-methyl-1-[(Z)-prop-1-enyl]hydrazine (PubChem CID 145001618) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is ethane;1-[(3Z)-hexa-1,3-dien-3-yl]-2-methyl-1-[(Z)-prop-1-enyl]hydrazine.
| Compound Name | ethane;1-[(3Z)-hexa-1,3-dien-3-yl]-2-methyl-1-[(Z)-prop-1-enyl]hydrazine |
|---|---|
| PubChem CID | 145001618 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | ethane;1-[(3Z)-hexa-1,3-dien-3-yl]-2-methyl-1-[(Z)-prop-1-enyl]hydrazine |
| SMILES | C=C/C(=C/CC)N(/C=C\C)NC.CC.CC |
| InChI | InChI=1S/C10H18N2.2C2H6/c1-5-8-10(7-3)12(11-4)9-6-2;2*1-2/h6-9,11H,3,5H2,1-2,4H3;2*1-2H3/b9-6-,10-8-;; |
| InChIKey | RPBWGBAFKZGRPR-VSNREZKLSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|