C13H22F3N3 — CID 178136820
3,4-dimethyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole;ethane (PubChem CID 178136820) has the molecular formula C13H22F3N3 and a molecular weight of 277.33 g/mol. Its IUPAC name is 3,4-dimethyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole;ethane.
| Compound Name | 3,4-dimethyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole;ethane |
|---|---|
| PubChem CID | 178136820 |
| Molecular Formula | C13H22F3N3 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3,4-dimethyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole;ethane |
| SMILES | CC.CC/C=C\C(=C/C1=C(C)N(C)NN1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N3.C2H6/c1-4-5-6-9(11(12,13)14)7-10-8(2)17(3)16-15-10;1-2/h5-7,15-16H,4H2,1-3H3;1-2H3/b6-5-,9-7+; |
| InChIKey | CDWJZJRUFZFNEO-HMERWLGPSA-N |
| XLogP | 3.65 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|