C14H24F3N3 — CID 178136839
ethane;3-ethyl-4-methyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole (PubChem CID 178136839) has the molecular formula C14H24F3N3 and a molecular weight of 291.36 g/mol. Its IUPAC name is ethane;3-ethyl-4-methyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole.
| Compound Name | ethane;3-ethyl-4-methyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole |
|---|---|
| PubChem CID | 178136839 |
| Molecular Formula | C14H24F3N3 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethane;3-ethyl-4-methyl-5-[(1E,3Z)-2-(trifluoromethyl)hexa-1,3-dienyl]-1,2-dihydrotriazole |
| SMILES | CC.CC/C=C\C(=C/C1=C(C)N(CC)NN1)C(F)(F)F |
| InChI | InChI=1S/C12H18F3N3.C2H6/c1-4-6-7-10(12(13,14)15)8-11-9(3)18(5-2)17-16-11;1-2/h6-8,16-17H,4-5H2,1-3H3;1-2H3/b7-6-,10-8+; |
| InChIKey | DXWIFNVQWSZYDX-ZGSKTAACSA-N |
| XLogP | 4.04 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|