C14H33N3O — CID 163989372
1-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1-N,4-N,4-trimethylpentane-1,4-diamine (PubChem CID 163989372) has the molecular formula C14H33N3O and a molecular weight of 259.44 g/mol. Its IUPAC name is 1-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1-N,4-N,4-trimethylpentane-1,4-diamine.
| Compound Name | 1-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1-N,4-N,4-trimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 163989372 |
| Molecular Formula | C14H33N3O |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.26 |
| IUPAC Name | 1-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1-N,4-N,4-trimethylpentane-1,4-diamine |
| SMILES | CNC(C)(C)CCCN(C)CCOCCN(C)C |
| InChI | InChI=1S/C14H33N3O/c1-14(2,15-3)8-7-9-17(6)11-13-18-12-10-16(4)5/h15H,7-13H2,1-6H3 |
| InChIKey | TZFWVTORXPRHAW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|