C21H23N2O3+ — CID 163989771
[(1R,7R,9S,11S)-1-methyl-6,15-dioxo-5-propan-2-yl-8-oxa-14-azapentacyclo[9.7.0.02,7.07,9.012,16]octadeca-2,4,12(16)-trien-11-yl]-methylidyneazanium (PubChem CID 163989771) has the molecular formula C21H23N2O3+ and a molecular weight of 351.43 g/mol. Its IUPAC name is [(1R,7R,9S,11S)-1-methyl-6,15-dioxo-5-propan-2-yl-8-oxa-14-azapentacyclo[9.7.0.02,7.07,9.012,16]octadeca-2,4,12(16)-trien-11-yl]-methylidyneazanium.
| Compound Name | [(1R,7R,9S,11S)-1-methyl-6,15-dioxo-5-propan-2-yl-8-oxa-14-azapentacyclo[9.7.0.02,7.07,9.012,16]octadeca-2,4,12(16)-trien-11-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 163989771 |
| Molecular Formula | C21H23N2O3+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [(1R,7R,9S,11S)-1-methyl-6,15-dioxo-5-propan-2-yl-8-oxa-14-azapentacyclo[9.7.0.02,7.07,9.012,16]octadeca-2,4,12(16)-trien-11-yl]-methylidyneazanium |
| SMILES | C#[N+][C@@]12C[C@@H]3O[C@@]34C(=O)C(C(C)C)=CC=C4[C@@]1(C)CCC1=C2CNC1=O |
| InChI | InChI=1S/C21H22N2O3/c1-11(2)12-5-6-15-19(3)8-7-13-14(10-23-18(13)25)20(19,22-4)9-16-21(15,26-16)17(12)24/h4-6,11,16H,7-10H2,1-3H3/p+1/t16-,19+,20+,21+/m0/s1 |
| InChIKey | GONSAQOONAVQQO-LLUDDFSJSA-O |
| XLogP | 2.55 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|