About 12-methyltricyclo[14.2.2.11,4]henicosane
12-methyltricyclo[14.2.2.11,4]henicosane (PubChem CID 163993467) has the molecular formula C22H40
and a molecular weight of 304.56 g/mol. Its IUPAC name is 12-methyltricyclo[14.2.2.11,4]henicosane.
Molecular Properties
| Compound Name | 12-methyltricyclo[14.2.2.11,4]henicosane |
| PubChem CID | 163993467 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 12-methyltricyclo[14.2.2.11,4]henicosane |
| SMILES | CC1CCCCCCCC2CCC3(CCC(CCC1)CC3)C2 |
| InChI | InChI=1S/C22H40/c1-19-8-5-3-2-4-6-10-21-14-17-22(18-21)15-12-20(13-16-22)11-7-9-19/h19-21H,2-18H2,1H3 |
| InChIKey | UCQMGXULZCFBSV-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 12-methyltricyclo[14.2.2.11,4]henicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methyltricyclo[14.2.2.11,4]henicosane?
The IUPAC name of 12-methyltricyclo[14.2.2.11,4]henicosane (CID 163993467) is 12-methyltricyclo[14.2.2.11,4]henicosane.
What is the SMILES notation for 12-methyltricyclo[14.2.2.11,4]henicosane?
The canonical SMILES for 12-methyltricyclo[14.2.2.11,4]henicosane is CC1CCCCCCCC2CCC3(CCC(CCC1)CC3)C2.
What is the InChIKey of 12-methyltricyclo[14.2.2.11,4]henicosane?
The InChIKey is UCQMGXULZCFBSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40/c1-19-8-5-3-2-4-6-10-21-14-17-22(18-21)15-12-20(13-16-22)11-7-9-19/h19-21H,2-18H2,1H3.
What are the key properties of 12-methyltricyclo[14.2.2.11,4]henicosane?
12-methyltricyclo[14.2.2.11,4]henicosane has a molecular weight of 304.56 g/mol, XLogP of 7.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methyltricyclo[14.2.2.11,4]henicosane is sourced from PubChem (CID 163993467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).