C18H19ClN4O3 — CID 163994451
1-(4-chlorophenyl)-3-[[(3S,4R)-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]amino]urea (PubChem CID 163994451) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[(3S,4R)-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[(3S,4R)-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]amino]urea |
|---|---|
| PubChem CID | 163994451 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[(3S,4R)-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]amino]urea |
| SMILES | COc1ccc([C@@H]2CNC(=O)[C@H]2NNC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-26-14-8-2-11(3-9-14)15-10-20-17(24)16(15)22-23-18(25)21-13-6-4-12(19)5-7-13/h2-9,15-16,22H,10H2,1H3,(H,20,24)(H2,21,23,25)/t15-,16-/m0/s1 |
| InChIKey | UDMBTWPDLJPPGZ-HOTGVXAUSA-N |
| XLogP | 2.26 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|