C13H14N2 — CID 163994606
5,6-dimethyl-6,7-dihydropyrido[3,2-b]indole (PubChem CID 163994606) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5,6-dimethyl-6,7-dihydropyrido[3,2-b]indole.
| Compound Name | 5,6-dimethyl-6,7-dihydropyrido[3,2-b]indole |
|---|---|
| PubChem CID | 163994606 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5,6-dimethyl-6,7-dihydropyrido[3,2-b]indole |
| SMILES | CC1CC=Cc2c1n(C)c1cccnc21 |
| InChI | InChI=1S/C13H14N2/c1-9-5-3-6-10-12-11(7-4-8-14-12)15(2)13(9)10/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | UDOUWZRYORGKSK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |