C37H56ClN3O10 — CID 163995181
1-chloroethyl N-[1-(2-methoxyphenyl)propan-2-yl]-N-methylcarbamate;1-[1-(2-methoxyphenyl)propan-2-yl-methylcarbamoyl]oxyethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 163995181) has the molecular formula C37H56ClN3O10 and a molecular weight of 738.32 g/mol. Its IUPAC name is 1-chloroethyl N-[1-(2-methoxyphenyl)propan-2-yl]-N-methylcarbamate;1-[1-(2-methoxyphenyl)propan-2-yl-methylcarbamoyl]oxyethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 1-chloroethyl N-[1-(2-methoxyphenyl)propan-2-yl]-N-methylcarbamate;1-[1-(2-methoxyphenyl)propan-2-yl-methylcarbamoyl]oxyethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 163995181 |
| Molecular Formula | C37H56ClN3O10 |
| Molecular Weight | 738.32 g/mol |
| Exact Mass | 737.37 |
| IUPAC Name | 1-chloroethyl N-[1-(2-methoxyphenyl)propan-2-yl]-N-methylcarbamate;1-[1-(2-methoxyphenyl)propan-2-yl-methylcarbamoyl]oxyethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COc1ccccc1CC(C)N(C)C(=O)OC(C)Cl.COc1ccccc1CC(C)N(C)C(=O)OC(C)OC(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36N2O7.C14H20ClNO3/c1-16(15-18-11-8-9-12-19(18)29-7)25(6)22(28)31-17(2)30-20(26)13-10-14-24-21(27)32-23(3,4)5;1-10(16(3)14(17)19-11(2)15)9-12-7-5-6-8-13(12)18-4/h8-9,11-12,16-17H,10,13-15H2,1-7H3,(H,24,27);5-8,10-11H,9H2,1-4H3 |
| InChIKey | UEBIKVALLHIZKW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.32 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|