C18H15ClIN3O2S — CID 163997233
methyl 6-[2-chloro-6-(1λ3-iodiran-1-yl)phenyl]-2-methylsulfanylpyrido[2,3-d]pyrimidine-7-carboxylate (PubChem CID 163997233) has the molecular formula C18H15ClIN3O2S and a molecular weight of 499.76 g/mol. Its IUPAC name is methyl 6-[2-chloro-6-(1λ3-iodiran-1-yl)phenyl]-2-methylsulfanylpyrido[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | methyl 6-[2-chloro-6-(1λ3-iodiran-1-yl)phenyl]-2-methylsulfanylpyrido[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 163997233 |
| Molecular Formula | C18H15ClIN3O2S |
| Molecular Weight | 499.76 g/mol |
| Exact Mass | 498.96 |
| IUPAC Name | methyl 6-[2-chloro-6-(1λ3-iodiran-1-yl)phenyl]-2-methylsulfanylpyrido[2,3-d]pyrimidine-7-carboxylate |
| SMILES | COC(=O)c1nc2nc(SC)ncc2cc1-c1c(Cl)cccc1I1CC1 |
| InChI | InChI=1S/C18H15ClIN3O2S/c1-25-17(24)15-11(8-10-9-21-18(26-2)23-16(10)22-15)14-12(19)4-3-5-13(14)20-6-7-20/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | UFUDWHDQJJHFSZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.76 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|