C14H8BrCl2N3S — CID 169075113
6-(4-bromo-2-chlorophenyl)-7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine (PubChem CID 169075113) has the molecular formula C14H8BrCl2N3S and a molecular weight of 401.12 g/mol. Its IUPAC name is 6-(4-bromo-2-chlorophenyl)-7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine.
| Compound Name | 6-(4-bromo-2-chlorophenyl)-7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 169075113 |
| Molecular Formula | C14H8BrCl2N3S |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 398.90 |
| IUPAC Name | 6-(4-bromo-2-chlorophenyl)-7-chloro-2-methylsulfanylpyrido[2,3-d]pyrimidine |
| SMILES | CSc1ncc2cc(-c3ccc(Br)cc3Cl)c(Cl)nc2n1 |
| InChI | InChI=1S/C14H8BrCl2N3S/c1-21-14-18-6-7-4-10(12(17)19-13(7)20-14)9-3-2-8(15)5-11(9)16/h2-6H,1H3 |
| InChIKey | HTWXVOCRDXTCNG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|