C15H11ClN4O4S — CID 87402397
(Z)-6-(2-chloro-4-nitrophenyl)-N-methoxy-2-methylsulfanylpyrano[2,3-d]pyrimidin-7-imine (PubChem CID 87402397) has the molecular formula C15H11ClN4O4S and a molecular weight of 378.80 g/mol. Its IUPAC name is (Z)-6-(2-chloro-4-nitrophenyl)-N-methoxy-2-methylsulfanylpyrano[2,3-d]pyrimidin-7-imine.
| Compound Name | (Z)-6-(2-chloro-4-nitrophenyl)-N-methoxy-2-methylsulfanylpyrano[2,3-d]pyrimidin-7-imine |
|---|---|
| PubChem CID | 87402397 |
| Molecular Formula | C15H11ClN4O4S |
| Molecular Weight | 378.80 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (Z)-6-(2-chloro-4-nitrophenyl)-N-methoxy-2-methylsulfanylpyrano[2,3-d]pyrimidin-7-imine |
| SMILES | CO/N=c1\oc2nc(SC)ncc2cc1-c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H11ClN4O4S/c1-23-19-14-11(10-4-3-9(20(21)22)6-12(10)16)5-8-7-17-15(25-2)18-13(8)24-14/h3-7H,1-2H3/b19-14- |
| InChIKey | ADEZZYZUBQVEFL-RGEXLXHISA-N |
| XLogP | 3.64 |
| TPSA | 103.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|