C15H13ClN4O6S — CID 42038325
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate (PubChem CID 42038325) has the molecular formula C15H13ClN4O6S and a molecular weight of 412.81 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 42038325 |
| Molecular Formula | C15H13ClN4O6S |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1nc(SC)ncc1Cl |
| InChI | InChI=1S/C15H13ClN4O6S/c1-25-11-5-8(20(23)24)3-4-10(11)18-12(21)7-26-14(22)13-9(16)6-17-15(19-13)27-2/h3-6H,7H2,1-2H3,(H,18,21) |
| InChIKey | DQYXQJBZYFXJRC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|