C10H14N2OSSi — CID 59814753
trimethyl-(2-methylsulfanylfuro[2,3-d]pyrimidin-6-yl)silane (PubChem CID 59814753) has the molecular formula C10H14N2OSSi and a molecular weight of 238.39 g/mol. Its IUPAC name is trimethyl-(2-methylsulfanylfuro[2,3-d]pyrimidin-6-yl)silane.
| Compound Name | trimethyl-(2-methylsulfanylfuro[2,3-d]pyrimidin-6-yl)silane |
|---|---|
| PubChem CID | 59814753 |
| Molecular Formula | C10H14N2OSSi |
| Molecular Weight | 238.39 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | trimethyl-(2-methylsulfanylfuro[2,3-d]pyrimidin-6-yl)silane |
| SMILES | CSc1ncc2cc([Si](C)(C)C)oc2n1 |
| InChI | InChI=1S/C10H14N2OSSi/c1-14-10-11-6-7-5-8(15(2,3)4)13-9(7)12-10/h5-6H,1-4H3 |
| InChIKey | LRBQDKMLMRHYQN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|