C16H18N2OS — CID 142801620
6-benzyl-2-methylsulfanylfuro[2,3-d]pyrimidine;ethane (PubChem CID 142801620) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 6-benzyl-2-methylsulfanylfuro[2,3-d]pyrimidine;ethane.
| Compound Name | 6-benzyl-2-methylsulfanylfuro[2,3-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 142801620 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 6-benzyl-2-methylsulfanylfuro[2,3-d]pyrimidine;ethane |
| SMILES | CC.CSc1ncc2cc(Cc3ccccc3)oc2n1 |
| InChI | InChI=1S/C14H12N2OS.C2H6/c1-18-14-15-9-11-8-12(17-13(11)16-14)7-10-5-3-2-4-6-10;1-2/h2-6,8-9H,7H2,1H3;1-2H3 |
| InChIKey | HZACAURNCLOUPY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |