C14H11NO — CID 10536385
2-benzylfuro[2,3-b]pyridine (PubChem CID 10536385) has the molecular formula C14H11NO and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-benzylfuro[2,3-b]pyridine.
| Compound Name | 2-benzylfuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 10536385 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-benzylfuro[2,3-b]pyridine |
| SMILES | c1ccc(Cc2cc3cccnc3o2)cc1 |
| InChI | InChI=1S/C14H11NO/c1-2-5-11(6-3-1)9-13-10-12-7-4-8-15-14(12)16-13/h1-8,10H,9H2 |
| InChIKey | QYNDWXJPHLKSLS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |