About 2-benzylfuro[2,3-b]pyridine
2-benzylfuro[2,3-b]pyridine (PubChem CID 10536385) has the molecular formula C14H11NO
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-benzylfuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-benzylfuro[2,3-b]pyridine |
| PubChem CID | 10536385 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-benzylfuro[2,3-b]pyridine |
| SMILES | c1ccc(Cc2cc3cccnc3o2)cc1 |
| InChI | InChI=1S/C14H11NO/c1-2-5-11(6-3-1)9-13-10-12-7-4-8-15-14(12)16-13/h1-8,10H,9H2 |
| InChIKey | QYNDWXJPHLKSLS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylfuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylfuro[2,3-b]pyridine?
The IUPAC name of 2-benzylfuro[2,3-b]pyridine (CID 10536385) is 2-benzylfuro[2,3-b]pyridine.
What is the SMILES notation for 2-benzylfuro[2,3-b]pyridine?
The canonical SMILES for 2-benzylfuro[2,3-b]pyridine is c1ccc(Cc2cc3cccnc3o2)cc1.
What is the InChIKey of 2-benzylfuro[2,3-b]pyridine?
The InChIKey is QYNDWXJPHLKSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO/c1-2-5-11(6-3-1)9-13-10-12-7-4-8-15-14(12)16-13/h1-8,10H,9H2.
What are the key properties of 2-benzylfuro[2,3-b]pyridine?
2-benzylfuro[2,3-b]pyridine has a molecular weight of 209.25 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylfuro[2,3-b]pyridine is sourced from PubChem (CID 10536385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).