C16H26N4O4 — CID 163998362
[3-(butylaminocarbamoyloxy)phenyl] N-(1-aminobutyl)carbamate (PubChem CID 163998362) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is [3-(butylaminocarbamoyloxy)phenyl] N-(1-aminobutyl)carbamate.
| Compound Name | [3-(butylaminocarbamoyloxy)phenyl] N-(1-aminobutyl)carbamate |
|---|---|
| PubChem CID | 163998362 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | [3-(butylaminocarbamoyloxy)phenyl] N-(1-aminobutyl)carbamate |
| SMILES | CCCCNNC(=O)Oc1cccc(OC(=O)NC(N)CCC)c1 |
| InChI | InChI=1S/C16H26N4O4/c1-3-5-10-18-20-16(22)24-13-9-6-8-12(11-13)23-15(21)19-14(17)7-4-2/h6,8-9,11,14,18H,3-5,7,10,17H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | UGSFRCPQSCHKSR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|