C30H53NO5S — CID 164508514
(4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]hexadeca-4,8,12-triene-1-sulfonic acid (PubChem CID 164508514) has the molecular formula C30H53NO5S and a molecular weight of 539.82 g/mol. Its IUPAC name is (4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]hexadeca-4,8,12-triene-1-sulfonic acid.
| Compound Name | (4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]hexadeca-4,8,12-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 164508514 |
| Molecular Formula | C30H53NO5S |
| Molecular Weight | 539.82 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | (4E,8E,12E)-3-hydroxy-2-[[(Z)-tetradec-9-enoyl]amino]hexadeca-4,8,12-triene-1-sulfonic acid |
| SMILES | CCC/C=C/CC/C=C/CC/C=C/C(O)C(CS(=O)(=O)O)NC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C30H53NO5S/c1-3-5-7-9-11-13-15-17-19-21-23-25-29(32)28(27-37(34,35)36)31-30(33)26-24-22-20-18-16-14-12-10-8-6-4-2/h7,9-10,12,15,17,23,25,28-29,32H,3-6,8,11,13-14,16,18-22,24,26-27H2,1-2H3,(H,31,33)(H,34,35,36)/b9-7+,12-10-,17-15+,25-23+ |
| InChIKey | ZWAUEDLUNMQGMC-DBIDROGSSA-N |
| XLogP | 7.23 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.82 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|