C33H59NO5S — CID 164502764
(E)-3-hydroxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentadec-4-ene-1-sulfonic acid (PubChem CID 164502764) has the molecular formula C33H59NO5S and a molecular weight of 581.90 g/mol. Its IUPAC name is (E)-3-hydroxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentadec-4-ene-1-sulfonic acid.
| Compound Name | (E)-3-hydroxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentadec-4-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 164502764 |
| Molecular Formula | C33H59NO5S |
| Molecular Weight | 581.90 g/mol |
| Exact Mass | 581.41 |
| IUPAC Name | (E)-3-hydroxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentadec-4-ene-1-sulfonic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NC(CS(=O)(=O)O)C(O)/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C33H59NO5S/c1-3-5-7-9-11-13-15-16-17-18-19-21-23-25-27-29-33(36)34-31(30-40(37,38)39)32(35)28-26-24-22-20-14-12-10-8-6-4-2/h5,7,11,13,16-17,26,28,31-32,35H,3-4,6,8-10,12,14-15,18-25,27,29-30H2,1-2H3,(H,34,36)(H,37,38,39)/b7-5-,13-11-,17-16-,28-26+ |
| InChIKey | ZKUBBAVWQBSYCF-FBPWEWOASA-N |
| XLogP | 8.40 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.90 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|