C37H65NO5S — CID 164508951
(4E,8E)-3-hydroxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]heptadeca-4,8-diene-1-sulfonic acid (PubChem CID 164508951) has the molecular formula C37H65NO5S and a molecular weight of 636.00 g/mol. Its IUPAC name is (4E,8E)-3-hydroxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]heptadeca-4,8-diene-1-sulfonic acid.
| Compound Name | (4E,8E)-3-hydroxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]heptadeca-4,8-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 164508951 |
| Molecular Formula | C37H65NO5S |
| Molecular Weight | 636.00 g/mol |
| Exact Mass | 635.46 |
| IUPAC Name | (4E,8E)-3-hydroxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]heptadeca-4,8-diene-1-sulfonic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)NC(CS(=O)(=O)O)C(O)/C=C/CC/C=C/CCCCCCCC |
| InChI | InChI=1S/C37H65NO5S/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-37(40)38-35(34-44(41,42)43)36(39)32-30-28-26-24-22-16-14-12-10-8-6-4-2/h5,7,11,13,17-18,22,24,30,32,35-36,39H,3-4,6,8-10,12,14-16,19-21,23,25-29,31,33-34H2,1-2H3,(H,38,40)(H,41,42,43)/b7-5-,13-11-,18-17-,24-22+,32-30+ |
| InChIKey | ZWWLZMOPNBKNQZ-QZNJHKDSSA-N |
| XLogP | 9.73 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.00 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|