C39H62O9 — CID 164509616
[1-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] acetate (PubChem CID 164509616) has the molecular formula C39H62O9 and a molecular weight of 674.92 g/mol. Its IUPAC name is [1-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] acetate.
| Compound Name | [1-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 164509616 |
| Molecular Formula | C39H62O9 |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.44 |
| IUPAC Name | [1-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] acetate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCOCC(COC1OC(CO)C(O)C(O)C1O)OC(C)=O |
| InChI | InChI=1S/C39H62O9/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-45-31-34(47-33(2)41)32-46-39-38(44)37(43)36(42)35(30-40)48-39/h4-5,7-8,10-11,13-14,16-17,19-20,22-23,34-40,42-44H,3,6,9,12,15,18,21,24-32H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | ZYCJOVFQJNHSET-IIBCDDELSA-N |
| XLogP | 6.35 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|