C24H26ClF2N3O4 — CID 164515413
3-[5-chloro-2-[2-[7,8-difluoro-2-(methylamino)-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-5-yl]ethoxy]phenyl]benzoic acid (PubChem CID 164515413) has the molecular formula C24H26ClF2N3O4 and a molecular weight of 493.94 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-[7,8-difluoro-2-(methylamino)-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-5-yl]ethoxy]phenyl]benzoic acid.
| Compound Name | 3-[5-chloro-2-[2-[7,8-difluoro-2-(methylamino)-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-5-yl]ethoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 164515413 |
| Molecular Formula | C24H26ClF2N3O4 |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 3-[5-chloro-2-[2-[7,8-difluoro-2-(methylamino)-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-5-yl]ethoxy]phenyl]benzoic acid |
| SMILES | CNC1NC(=O)C2C(CCOc3ccc(Cl)cc3-c3cccc(C(=O)O)c3)CC(F)C(F)C2N1 |
| InChI | InChI=1S/C24H26ClF2N3O4/c1-28-24-29-21-19(22(31)30-24)13(10-17(26)20(21)27)7-8-34-18-6-5-15(25)11-16(18)12-3-2-4-14(9-12)23(32)33/h2-6,9,11,13,17,19-21,24,28-29H,7-8,10H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | OXRXMTTVMJBPFK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |