C26H30N4O — CID 164519484
1,2-bis[5-(3-phenylpropyl)-1H-imidazol-2-yl]ethanol (PubChem CID 164519484) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is 1,2-bis[5-(3-phenylpropyl)-1H-imidazol-2-yl]ethanol.
| Compound Name | 1,2-bis[5-(3-phenylpropyl)-1H-imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 164519484 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1,2-bis[5-(3-phenylpropyl)-1H-imidazol-2-yl]ethanol |
| SMILES | OC(Cc1ncc(CCCc2ccccc2)[nH]1)c1ncc(CCCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C26H30N4O/c31-24(26-28-19-23(30-26)16-8-14-21-11-5-2-6-12-21)17-25-27-18-22(29-25)15-7-13-20-9-3-1-4-10-20/h1-6,9-12,18-19,24,31H,7-8,13-17H2,(H,27,29)(H,28,30) |
| InChIKey | ZMPVHMJUCKREDO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |